Está en la página 1de 21

EXPERIMENTO N05: RECONOCIMIENTO DEL NITROGENO:METODO DEL POTASIO METALICO

Este mtodo consiste en transformar en cianuro de potasio la sustanciaque se investiga, cuando esta es tratada con potasio metlico.Colocar un fragmento de potasio metalico recin cortado en un tubo deensayo seco, agregar la sustancia problema seca, procurando que serecubra el potasio metalico. Se calienta suavemente en el mecherodefendiendo la boca del tubo con un embudo de vidrio para evitar la proyeccin del potasio. Cuando el tubo esta incandescente se introduceen un vaso que contiene 15 a 20 ml. De agua destilada. Luego se filtra.C +N +K +Calor -------KCNEn el lquido filtrado se comprueba la reaccin, alcalinizada, si el licor nocolorea, en azul el papel de tornasol. Luego se aade gota a gota unasolucin reciente de Sulfato Ferroso, en el cual se forma ferrocianuro depotasio.6kCN + FeSO4 ---------Fe(CN)6 K4 + K2SO4En seguida se agrega gotas de solucin de sal frrica, formndose unasal doble de color, azul, el ferrocianuro frrico. (AZUL DE PRUSIA). El azulde Prusia se forma en medio acido. Para lo cual se acidula con una o dosgotas de acido clorhdrico.3 Fe (CN) 6K4 + 4 Cl3Fe -------12Cl + (Fe(CN6))3Fe4

Input Equation NH4NO2 = N2 + H2O Na+H2O=NaOH+H2 NaPO3 + SiO2 + Al = Na2SiO3 + Al2O3 + P4 Na2SiO3+8HF=H2SiF6+2NaF+3H2O NH3+C2=CH2+NC N2 + H2= NH3 NO2+H2O=HNO3+HNO2 N2+O2=NO N2+O2=NO N+Cl=NCl NaCl+SO2+O2+H2O=Na2SO4+HCl NH3+O2=NO2+H2O Na + H2O = NaOH + H2 Na2CO3 +CaCl2 = CaCO3 +NaCl

Balanced Equation NH4NO2 = N2 + 2H2O 2Na + 2H2O = 2NaOH + H2 12NaPO3 + 6SiO2 + 20Al = 6Na2SiO3 + 10Al2O3 + 3P4 Na2SiO3 + 8HF = H2SiF6 + 2NaF + 3H2O 4NH3 + 5C2 = 6CH2 + 4NC N2 + 3H2 = 2NH3 2NO2 + H2O = HNO3 + HNO2 N2 + O2 = 2NO N2 + O2 = 2NO N + Cl = NCl 4NaCl + 2SO2 + O2 + 2H2O = 2Na2SO4 + 4HCl 4NH3 + 7O2 = 4NO2 + 6H2O 2Na + 2H2O = 2NaOH + H2 Na2CO3 + CaCl2 = CaCO3 + 2NaCl

Na+H2O=NaOH+H2 NaNO3 = NaNO2 + O2 Na2SO4 + H2SO4 = NaHSO4 Na+O2=Na2O NO2+H2O=HNO3+NO NH3+H2SO4=(NH4)2SO4 Na + HOH = NaOH + H2 N2+F2=NF3 N2+F2=NF3 NaIO3+SO2 = Na2SO4+SO3+I2 NH4NO3=N2O+H2O Na3PO4+CaCl2=NaCl+Ca3(PO4)2 NaF+Br2=NaBr+F2 N2+H2=NH3 Na2SO3 (s) + HCl (l) = NaCl (aq) +H2SO3 NH3+H2SO4=(NH4)2SO4 NaNO3=NaNO2+O2 Na+H2O=NaOH+H2 Na + Cl2=NaCl2 NaOH + NH4Cl=NH4OH + NaCl Na3PO4 + Ba(ClO3)2 = Ba3(PO4)2 + NaClO3 Na(ClO)+Fe(SO4)+H2(SO4)=NaCl+Fe2(SO4)3+H2O N+3H = 2NH N+H = NH NH3 + H2O = NH4 + OH NH3 + H2O = N4 + OH Na2SO4+Ba(NO3)2= BaSO4+ NaNO3 NH3 + H2SO4 = (NH4)2SO4

2Na + 2H2O = 2NaOH + H2 2NaNO3 = 2NaNO2 + O2 Na2SO4 + H2SO4 = 2NaHSO4 4Na + O2 = 2Na2O 3NO2 + H2O = 2HNO3 + NO 2NH3 + H2SO4 = (NH4)2SO4 2Na + 2HOH = 2NaOH + H2 N2 + 3F2 = 2NF3 N2 + 3F2 = 2NF3 2NaIO3 + 5SO2 = Na2SO4 + 4SO3 + I2 NH4NO3 = N2O + 2H2O 2Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2 2NaF + Br2 = 2NaBr + F2 N2 + 3H2 = 2NH3 Na2SO3(s) + 2HCl(l) = 2NaCl(aq) + H2SO3 2NH3 + H2SO4 = (NH4)2SO4 2NaNO3 = 2NaNO2 + O2 2Na + 2H2O = 2NaOH + H2 Na + Cl2 = NaCl2 NaOH + NH4Cl = NH4OH + NaCl 2Na3PO4 + 3Ba(ClO3)2 = Ba3(PO4)2 + 6NaClO3 Na(ClO) + 2Fe(SO4) + H2(SO4) = NaCl + Fe2(SO4)3 + H2O N + H = NH N + H = NH NH3 + H2O = NH4 + OH -4NH3 + 12H2O = -1N4 + 12OH Na2SO4 + Ba(NO3)2 = BaSO4 + 2NaNO3 2NH3 + H2SO4 =

(NH4)2SO4 2NH3 + H2SO4 = NH3 + H2SO4 = (NH4)2SO4 (NH4)2SO4 2NaOH + H2SO4 = NaOH + H2SO4 = Na2SO4 + H2O Na2SO4 + 2H2O N2+H2=NH3 N2 + 3H2 = 2NH3 Na2CO3 + S + SO2 = Na2CO3+S+SO2=CO2+Na2S2O3 CO2 + Na2S2O3 8Na2SO3 + S8 = Na2SO3+S8=Na2S2O3 8Na2S2O3 Ni(OH)2 + 2HNO3 = Ni(OH)2+2HNO3=Ni(NO3)2+2H2O Ni(NO3)2 + 2H2O 4NH3 + 3F2 = 3NH4F + NH3+F2=NH4F+NF3 NF3 2Na + 2H2O = 2NaOH + Na + H2O = NaOH + H2 H2 Na+Cl2=NaCl 2Na + Cl2 = 2NaCl NH3=N2+H2 2NH3 = N2 + 3H2 N2 + H2 = NH3 N2 + 3H2 = 2NH3 4NH3(g) + 5O2(g) = NH3(g) + O2(g) = NO(g) + H2O(g) 4NO(g) + 6H2O(g) 2NaBH4(s) + H2SO4(aq) NaBH4(s) + H2SO4(aq) = B2H6(g) + H2(g) + Na2SO4(aq) = B2H6(g) + 2H2(g) + Na2SO4(aq) 2NaNO3(s) + H2SO4(aq) NaNO3(s) + H2SO4(aq) = Na2SO4(aq) + HNO3(g) = Na2SO4(aq) + 2HNO3(g) 2NaHCO3 + H3PO4 = NaHCO3+H3PO4=Na2HPO4+H2O+CO2 Na2HPO4 + 2H2O + 2CO2 3NO2(g) + H2O(l) = NO2(g)+H2O(l)=HNO3 (aq)+NO (g) 2HNO3(aq) + NO(g) N2+O2=NO N2 + O2 = 2NO NiS+O2=NiO+S02 2NiS + O2 = 2NiO + S02 2NH3 + H2CO3 = NH3 + H2CO3 = (NH4)2CO3 (NH4)2CO3 3NO2 + H2O = 2HNO3 + NO2 + H2O = HNO3 + NO NO 2NH3 + 3N2O = 4N2 + NH3 + N2O = N2 + H2O 3H2O N2+H2=NH3 N2 + 3H2 = 2NH3 NH4OH + H2SO4 = NH4OH + H2SO4 = NH4SO4 + H3O NH4SO4 + H3O NH4OH + H2SO4 = NH4SO4 + H2OH NH4OH + H2SO4 =

Na2CO3 + HCl = Na2Cl + HCO3 NaCl + AgNO3 = NaNO3 + AgCl NaCl + KNO3 = NaNO3 + KCl Na+H2O=NaOH+H NH3(g) + HCl(g) = NH4Cl(s) NaOH + H2SO4 = Na2SO4 + H2O N2 + H2 = NH3 Na + H2O = NaOH + H2 NaOH + HCl = NaCl + H2O NaHCO3 + HCl = CO2 + NaCl + H2O Na3PO4+BaCl2=Ba3(PO4)2+NaCl Na(OH) + Mg(NO3)2 = Na(NO3) +Mg(OH)2 Na(OH) + Ba(Cl)2 = NaCl +Ba(OH)2 Na(OH) + Pb(C2H3O2)2 = Na(C2H3O2) +Pb(OH)2

Na(OH) + Pb(C2H3O2)2 = Na(C2H3O2) +Pb(OH)2 NaOH+H2SO4=Na2SO4+H2O NaCl + F2 = NaF + Cl2 N2 + H2 = NH3 NaCl+F2=NaF+Cl2 NaBr + CaF2 = NaF + CaBr2 Na+H2O=NaOH+H2 N2+3H2=NH3 Na + H2O = NaOH + H2 Na + H2O = H2 + NaO

NH4SO4 + H2OH Na2CO3 + HCl = Na2Cl + HCO3 NaCl + AgNO3 = NaNO3 + AgCl NaCl + KNO3 = NaNO3 + KCl Na + H2O = NaOH + H NH3(g) + HCl(g) = NH4Cl(s) 2NaOH + H2SO4 = Na2SO4 + 2H2O N2 + 3H2 = 2NH3 2Na + 2H2O = 2NaOH + H2 NaOH + HCl = NaCl + H2O NaHCO3 + HCl = CO2 + NaCl + H2O 2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl 2Na(OH) + Mg(NO3)2 = 2Na(NO3) + Mg(OH)2 2Na(OH) + Ba(Cl)2 = 2NaCl + Ba(OH)2 2Na(OH) + Pb(C2H3O2)2 = 2Na(C2H3O2) + Pb(OH)2 2Na(OH) + Pb(C2H3O2)2 = 2Na(C2H3O2) + Pb(OH)2 2NaOH + H2SO4 = Na2SO4 + 2H2O 2NaCl + F2 = 2NaF + Cl2 N2 + 3H2 = 2NH3 2NaCl + F2 = 2NaF + Cl2 2NaBr + CaF2 = 2NaF + CaBr2 2Na + 2H2O = 2NaOH + H2 N2 + 3H2 = 2NH3 2Na + 2H2O = 2NaOH + H2 Na + H2O = H2 + NaO

Na + H2O = H2 + NaOH NaCl+KNO3= NaNO3+KCl NaCl+KNO3= NaNO3+KCl Na+Cl2=NaCl NH4NO3 = N2O + H2O NH3 + NO1 = N + H2O N2O5 + H2O = HNO3 NH4Cl(aq)+NaOH(aq)=H2O(l)+NH3(g)+NaCl(aq) Na2CO3 + HCl = NaCl + H2O +CO2 Na2CO3 + HCl = NaCl + H2O + CO2 NaHCO3= Na2CO3+CO2+H2O Na+Cl2=NaCl NH4NO2=N2 + H2O NaIO4+NaI+HBr=NaBr+I2+H2O Na + H2O = NaOH + H Na+H2O=NaOH2 NO3Ag+NaCl = NO3Na + ClAg NO3Ag+ClNa = NO3Na + ClAg NaNO2 + FeCl3 = NaCl + Cl2 + FeNO2 NH3=N2+H2 NaBr+NaBrO3+H2SO4= Br2+Na2SO4+H2O NH3 + O2 = NO + H2O NiSO4+Li3PO4= Ni3(PO4)2+Li2SO4 Na2S2O3 + I2 = NaI + Na2S4O6 NaOH+H2S=Na2S+H2O

2Na + 2H2O = H2 + 2NaOH NaCl + KNO3 = NaNO3 + KCl NaCl + KNO3 = NaNO3 + KCl 2Na + Cl2 = 2NaCl NH4NO3 = N2O + 2H2O 2NH3 + 3NO1 = 5N + 3H2O N2O5 + H2O = 2HNO3 NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq) Na2CO3 + 2HCl = 2NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2 2NaHCO3 = Na2CO3 + CO2 + H2O 2Na + Cl2 = 2NaCl NH4NO2 = N2 + 2H2O NaIO4 + 7NaI + 8HBr = 8NaBr + 4I2 + 4H2O Na + H2O = NaOH + H Na + H2O = NaOH2 NO3Ag + NaCl = NO3Na + ClAg NO3Ag + ClNa = NO3Na + ClAg NaNO2 + FeCl3 = NaCl + Cl2 + FeNO2 2NH3 = N2 + 3H2 5NaBr + NaBrO3 + 3H2SO4 = 3Br2 + 3Na2SO4 + 3H2O 4NH3 + 5O2 = 4NO + 6H2O 3NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4 2Na2S2O3 + I2 = 2NaI + Na2S4O6 2NaOH + H2S = Na2S + 2H2O

NH3+O2=NO+H2O Na+Cl2=NaCl NaNO3= NaNO2+O2 Na+H2O=NaOH+H2O Na+O2=Na2O2 Na+H2O=NaOH+H2 NH3=N2+H2 Na+O2=NaO2 Na+O2=NaO2 Na+O2=NaO2 Na+O2=NaO Na(s)+ H2O(l)= NaOH(aq)+H2(g) Na(s)+ H2O(l)= NaOH(aq)+H2(g) NaBr (aq) + Cl2 (g)=NaCl (aq) + Br2 (g) Na (s) + H2O (l)=NaOH (aq) + H2 (g) NH4NO3=N2O+H2O N2+H2=NH3 NH3+SO3+H2O=(NH4)2SO4 Na3 + SCN = NaSCN NaCl+Hg2(C2H3O2)2=Hg2Cl2+NaC2H3O2 NaNO3+PbO=Pb(NO3)2+Na2O NH4NO3 =N2O + H2O NO3- + H- + Zn- = NH4+ + Zn++ + H2O Na2CO3 + HNO3 = Na2NO3 + HCO3 NO2 (g) + H2O (l)= HNO3 (aq) + NO (g) NaBr+H2SO4=Na2SO4+HBr N2+H2=NH3 NaCl + HNO3 + AgNO3 = NaNO +Ag + NO +HCl NH3NO3=N+O2+H2O

4NH3 + 5O2 = 4NO + 6H2O 2Na + Cl2 = 2NaCl 2NaNO3 = 2NaNO2 + O2 0Na + H2O = 0NaOH + H2O 2Na + O2 = Na2O2 2Na + 2H2O = 2NaOH + H2 2NH3 = N2 + 3H2 Na + O2 = NaO2 Na + O2 = NaO2 Na + O2 = NaO2 2Na + O2 = 2NaO 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) 2NaBr(aq) + Cl2(g) = 2NaCl(aq) + Br2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) NH4NO3 = N2O + 2H2O N2 + 3H2 = 2NH3 2NH3 + SO3 + H2O = (NH4)2SO4 Na3 + 3SCN = 3NaSCN 2NaCl + Hg2(C2H3O2)2 = Hg2Cl2 + 2NaC2H3O2 2NaNO3 + PbO = Pb(NO3)2 + Na2O NH4NO3 = N2O + 2H2O NO3- + 10H- - 4Zn- = NH4+ - 4Zn++ + 3H2O Na2CO3 + HNO3 = Na2NO3 + HCO3 3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g) 2NaBr + H2SO4 = Na2SO4 + 2HBr N2 + 3H2 = 2NH3 NaCl + HNO3 - AgNO3 = NaNO - Ag - NO + HCl 4NH3NO3 = 8N + 3O2 +

N2H4 (l)= NH3 (g) + N2 (g) NF3+H2O=HF+NO+NO2 Na2SO4 + AgNO3 = NaNO3 + Ag2SO4 N2O5+H2O=HNO3 NH3 + CuO = Cu + N2 + H2O NH4NO2 = N2 + H2O NH4NO3 = N2O + H2O NH4NO3 = N2O + H2O N2O5 = N2O4 + O2 Ni3(PO4)2+H2SO4=NiSO4+H3PO4 NaOH + H2SO4 = Na2SO4 + H2O N2 + H2 = NH3 NH4NO3=N2+O2+H20 Na + H2O = NaOH + H2O Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl NH4OH + H2SO4 = (NH4)2SO4 + HOH Na +O2=NaO2 Na+H2O=NaOH+H2 NaCl+H2SO4=HCl+Na2SO4 Na2O2+H2O=NaOH+H2O2 N2O5(g)+H2O(l) =HNO3(aq) NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)

NaOH(aq) + Al(NO3)3(aq) = NaNO3(aq) + Al(OH)3 (aq)

Na3PO4(aq) + AgNO3(aq) = NaNO3(aq) + Ag3PO4(aq)

6H2O 3N2H4(l) = 4NH3(g) + N2(g) 2NF3 + 3H2O = 6HF + NO + NO2 Na2SO4 + 2AgNO3 = 2NaNO3 + Ag2SO4 N2O5 + H2O = 2HNO3 2NH3 + 3CuO = 3Cu + N2 + 3H2O NH4NO2 = N2 + 2H2O NH4NO3 = N2O + 2H2O NH4NO3 = N2O + 2H2O 2N2O5 = 2N2O4 + O2 Ni3(PO4)2 + 3H2SO4 = 3NiSO4 + 2H3PO4 2NaOH + H2SO4 = Na2SO4 + 2H2O N2 + 3H2 = 2NH3 10NH4NO3 = 10N2 + 15O2 + 2H20 0Na + H2O = 0NaOH + H2O 2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl 2NH4OH + H2SO4 = (NH4)2SO4 + 2HOH Na + O2 = NaO2 2Na + 2H2O = 2NaOH + H2 2NaCl + H2SO4 = 2HCl + Na2SO4 Na2O2 + 2H2O = 2NaOH + H2O2 N2O5(g) + H2O(l) = 2HNO3(aq) 2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l) 3NaOH(aq) + Al(NO3)3(aq) = 3NaNO3(aq) + Al(OH)3(aq) Na3PO4(aq) + 3AgNO3(aq) =

Na(s) + H2O(l) = NaOH(aq) + H2(g) NaNO3 + H2SO4 = Na2SO4 +HNO3 NO3- + H- + Zn = NH4- + Zn++ + H2O NH3+O2=NO+H2O NH3 + O2 + CH4 = HCN + H2O Na + Cl2 = NaCl NaNO3=NaNO2+O2 Na+O2=Na2O NH3+O2=NO+H2O N2+H2=NH3 NaOH+AlBr3=NaBr+Al(OH)3 Na2+Cl2=Na2Cl2 Na2+Cl2=2NaCl NH3 + O2 = NO+H2O NaNO3 + Al + NaOH + H2O = NaAlO2 + NH3 N2+H2=NH3 NaHCO3 = Na2CO3 + CO2 + H2O Na2CO3 +CaCl2 = CaCO3 +NaCl NH3+O2=NO+H2O Na(s)+H2O(l) = NaOH(aq) + H2 (g) NaClO+FeSO4+H2SO4=NaCl+Fe2(SO4)3+H2O NaHSO3=Na2SO3+SO2+H2O NaNO3 + Al + NaOH + H20 = NaAlO2 + NH3

3NaNO3(aq) + Ag3PO4(aq) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3 NO3- + 10H- - 5Zn = NH4- 5Zn++ + 3H2O 4NH3 + 5O2 = 4NO + 6H2O 2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O 2Na + Cl2 = 2NaCl 2NaNO3 = 2NaNO2 + O2 4Na + O2 = 2Na2O 4NH3 + 5O2 = 4NO + 6H2O N2 + 3H2 = 2NH3 3NaOH + AlBr3 = 3NaBr + Al(OH)3 Na2 + Cl2 = Na2Cl2 Na2 + Cl2 = 2NaCl 4NH3 + 5O2 = 4NO + 6H2O 3NaNO3 + 8Al + 5NaOH + 2H2O = 8NaAlO2 + 3NH3 N2 + 3H2 = 2NH3 2NaHCO3 = Na2CO3 + CO2 + H2O Na2CO3 + CaCl2 = CaCO3 + 2NaCl 4NH3 + 5O2 = 4NO + 6H2O 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) NaClO + 2FeSO4 + H2SO4 = NaCl + Fe2(SO4)3 + H2O 2NaHSO3 = Na2SO3 + SO2 + H2O 10NaNO3 + 20Al + 10NaOH + H20 = 20NaAlO2 + 10NH3

NaHCO3 + H2SO4 = H2O+ Na2SO4 + CO2 Na2CO3+HCl=NaCl+CO2+H2O Na2O+H2O=NaOH NH3+O2=NO+H2O NaBr + NH4Cl = NH4Br + NaCl NaCl+Na2Co3=NaCo3+NaCl NaHCO3 + CoCl2 = CoHCO3 + NaCl2 Na(s)+O2(g)=NaO2 NH3+CuO=N2+H2O+Cu NH3+CuO=N2+H2O+Cu Na2S2O3+HCl=NaCl+SO2+S+H2O NH3+O2=NO+H2O Na2CO3+HCl=NaCl+CO2+H2O NH4OH+H2SO4=(NH4)2SO4+H2O NH3+O2=NO+H2O NaCl+H2O=Cl2+H2+NaOH NH3+H2SO4=(NH4)2SO4 N2O5 = NO2 + O2 NO+O2 = NO2 NiBr2 + KOH = Ni(OH)2 +KBr N2O5+H2O=HNO3 Na2CO3 + HCl = NaCl + H2CO3 Na2CO3 + 2H2O = 2NaOH + H2CO3 Ni(NO3)2+Na3PO4=Ni3(PO4)2+NaNO3 Na2CO3 + 2H2O =2NaOH +H2CO3

2NaHCO3 + H2SO4 = 2H2O + Na2SO4 + 2CO2 Na2CO3 + 2HCl = 2NaCl + CO2 + H2O Na2O + H2O = 2NaOH 4NH3 + 5O2 = 4NO + 6H2O NaBr + NH4Cl = NH4Br + NaCl NaCl + 0Na2Co3 = 0NaCo3 + NaCl NaHCO3 + CoCl2 = CoHCO3 + NaCl2 Na(s) + O2(g) = NaO2 2NH3 + 3CuO = N2 + 3H2O + 3Cu 2NH3 + 3CuO = N2 + 3H2O + 3Cu Na2S2O3 + 2HCl = 2NaCl + SO2 + S + H2O 4NH3 + 5O2 = 4NO + 6H2O Na2CO3 + 2HCl = 2NaCl + CO2 + H2O 2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O 4NH3 + 5O2 = 4NO + 6H2O 2NaCl + 2H2O = Cl2 + H2 + 2NaOH 2NH3 + H2SO4 = (NH4)2SO4 2N2O5 = 4NO2 + O2 2NO + O2 = 2NO2 NiBr2 + 2KOH = Ni(OH)2 + 2KBr N2O5 + H2O = 2HNO3 Na2CO3 + 2HCl = 2NaCl + H2CO3 Na2CO3 + 2H2O = 2NaOH + H2CO3 3Ni(NO3)2 + 2Na3PO4 = Ni3(PO4)2 + 6NaNO3 Na2CO3 + 2H2O =

Na2CO3+H2O=NaOH+ H2CO3 Na2CO3+H2O=NaOH+ H2CO3 NH3+H2SO4=(NH4)2SO4 Na3PO4+CaCl2=NaCl+Ca3(PO4)2 NaOH + KMnO4 = NaMnO4 + KOH NH3+O2 = NO + H2O NaHCO3 + HCl = NaCl + H2O + CO2 Na2CO3 + BaCl2= NaCl + BaCO3 Na+Cl2=NaCl NH4Cl+Ca(OH)2=NH3+CaCl2+H2O NaHCO3+C2H4O2=NaC2H3O2+H2O+CO2 NH4NO3=N2+O2+H2O NaCL+H2SO4=HCL+Na2SO4 N2(g)+H2(g)=NH3(g) Na2O2+H2O=NaOH+H2O2 NO + CrCl2 + HCl = CrCl3 + N2 + H2O NaI + H2SO4 +MnO2 = I2 +Mn + Na2SO4 + H2O N2H4 + KIO3 = N2 +KI + H2O NH3+O2=NO2+H2O NO2 + H2O = HNO3 +HNO2 NO + O2 = NO2 N2 +O2 = 2NO NH3(g) +O2(g) =N2(g) +H2O(g)

2NaOH + H2CO3 Na2CO3 + 2H2O = 2NaOH + H2CO3 Na2CO3 + 2H2O = 2NaOH + H2CO3 2NH3 + H2SO4 = (NH4)2SO4 2Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2 NaOH + KMnO4 = NaMnO4 + KOH 4NH3 + 5O2 = 4NO + 6H2O NaHCO3 + HCl = NaCl + H2O + CO2 Na2CO3 + BaCl2 = 2NaCl + BaCO3 2Na + Cl2 = 2NaCl 2NH4Cl + Ca(OH)2 = 2NH3 + CaCl2 + 2H2O NaHCO3 + C2H4O2 = NaC2H3O2 + H2O + CO2 2NH4NO3 = 2N2 + O2 + 4H2O 2NaCL + H2SO4 = 2HCL + Na2SO4 N2(g) + 3H2(g) = 2NH3(g) Na2O2 + 2H2O = 2NaOH + H2O2 2NO + 4CrCl2 + 4HCl = 4CrCl3 + N2 + 2H2O 4NaI + 2H2SO4 + MnO2 = 2I2 + Mn + 2Na2SO4 + 2H2O 3N2H4 + 2KIO3 = 3N2 + 2KI + 6H2O 4NH3 + 7O2 = 4NO2 + 6H2O 2NO2 + H2O = HNO3 + HNO2 2NO + O2 = 2NO2 N2 + O2 = 2NO 4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)

N2O5+H2O=HNO3

N2O5 + H2O = 2HNO3 NiCl3 + 3AgNO3 = 3AgCl NiCl3 + AgNO3 = AgCl + Ni(NO3)3 + Ni(NO3)3 2Na + 2H2O = 2NaOH + Na + H2O = NaOH + H2 H2 3Na(OH(aq)) + Na(OH(aq))+H3PO4(aq)=Na3PO4(aq)+H2O(l) H3PO4(aq) = Na3PO4(aq) + 3H2O(l) 3Na(OH(aq)) + Na(OH(aq))+H3PO4(aq)=Na3PO4(aq)+H2O(l) H3PO4(aq) = Na3PO4(aq) + 3H2O(l) NH4NO3=N2O+H2O NH4NO3 = N2O + 2H2O Na+Cl2=NaCl 2Na + Cl2 = 2NaCl NH3=N2+H2 2NH3 = N2 + 3H2 2Na + 2H2O = 2NaOH + Na+H2O=NaOH+H2 H2 Na2O+H2O=NaOH Na2O + H2O = 2NaOH 2NaHCO3 = Na2CO3 + NaHCO3=Na2CO3+H2O+CO2 H2O + CO2 N2H4 = NH3 = N2 3N2H4 = 4NH3 + N2 NH3=N2+H2 2NH3 = N2 + 3H2 Na2CO3 + 2HCl = CO2 + Na2CO3+HCl=CO2+H2O+NaCl H2O + 2NaCl 4NH3(g) + 7O2(g) = NH3(g) + O2(g) = NO2(g) + H2O(g) 4NO2(g) + 6H2O(g) 2Na + 2H2O = 2NaOH + Na+H2O=NaOH+H2 H2 2NaOH + SO3 = Na2SO4 NaOH+SO3=Na2SO4+H2O + H2O 2NaHCO3(aq) + H2SO4(aq) = NaHCO3(aq)+H2SO4(aq)=Na2SO4(aq)+H2O(l)+CO2(g) Na2SO4(aq) + 2H2O(l) + 2CO2(g) 2Na + 2H2O = 2NaOH + Na+H2O=NaOH+H2 H2 NaOH + HCl = NaCl + NaOH+HCl=NaCl+H2O H2O Na2O+H2O=NaOH Na2O + H2O = 2NaOH Na+H2O=Na2O+H2 2Na + H2O = Na2O + H2 2Na2O + 2Cl2 = 4NaCl + Na2O+Cl2=NaCl+O2 O2 Na2O+Cl2=NaCl+O Na2O + Cl2 = 2NaCl + O 2NaHCO3 + H2SO4 = NaHCO3+H2SO4=Na2SO4+H2O+CO2 Na2SO4 + 2H2O + 2CO2

NO2=NO+O2 N2+Cl2=NCl

2NO2 = 2NO + O2 N2 + Cl2 = 2NCl 3NaHCO3 + H3C6H5O7 = NaHCO3 + H3C6H5O7 = CO2 + Na3C6H5O7 + H2O 3CO2 + Na3C6H5O7 + 3H2O Na(s)+Ca2=Na(Ca)2 Na(s) + Ca2 = Na(Ca)2 Na(s)+Ca2=Na(Ca)2 Na(s) + Ca2 = Na(Ca)2 2NaHCO3(s) = NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(l) Na2CO3(s) + CO2(g) + H2O(l) 2NaHCO3(aq) = NaHCO3(aq) = Na2CO3(s) + CO2(g) + H2O(l) Na2CO3(s) + CO2(g) + H2O(l) NaHCO3 + H3PO4 = H2O NaHCO3+H3PO4=H2O +CO2+NaH2PO4 + CO2 + NaH2PO4 NaOH + AgNO3 = NaNO3 NaOH + AgNO3 = NaNO3 + AgOH + AgOH Na2CO3 + Al = AlCO3 + Na2CO3 + Al = AlCO3 + Na 2Na Na2SO4(aq) + Na2SO4 (aq) + Ba(NO3)2 (aq) = BaSO4 (aq) + 2Na(NO3) Ba(NO3)2(aq) = BaSO4(aq) + 2Na(NO3) NH4OH(aq) = NH3(g) + NH4OH(aq)=NH3(g)+H2O(l) H2O(l) 2NaCl + Br2 = 2NaBr + NaCl+Br2=NaBr+Cl 2Cl 2NH4NO3(s) = 2N2(g) + NH4NO3(s) = N2(g) + O2(g) + H2O(g) O2(g) + 4H2O(g) NaCN(aq) + HNO3(aq) = NaCN(aq) + HNO3(aq) = NaNO3(aq) + HCN(aq) NaNO3(aq) + HCN(aq) -1NaNO2 - 2Al - KOH = NaNO2 + Al + KOH = NaAlO2 + KAlO2 + NH3 + H2O 1NaAlO2 - KAlO2 - NH3 + H2O 2NaNO3 + 8Zn + 14KOH NaNO3 + Zn + KOH = Na2ZnO2 + K2ZnO2 + NH3 + H2O = Na2ZnO2 + 7K2ZnO2 + 2NH3 + 4H2O Ni(s) + 2HCl(aq) = Ni(s)+HCl(aq)=NiCl2(aq)+H2(g) NiCl2(aq) + H2(g) -1NaNO2 - 2Al - KOH = NaNO2 + Al + KOH = NaAlO2 + KAlO2 + NH3 + H2O 1NaAlO2 - KAlO2 - NH3 + H2O 0NaNO3 + 10Zn + 20KOH NaNO3 + Zn + KOH = Na2ZnO2 + K2ZnO2 + NH3 + H20 = 0Na2ZnO2 + 10K2ZnO2 + 0NH3 + H20 NaNO3 + Zn + KOH = Na2ZnO2 + K2ZnO2 + NH3 + H20 0NaNO3 + 10Zn + 20KOH

NH3 + HCl = NH4Cl Na2S2O3 + I2 = NaI + Na2S4O6 N2 +Cl2 = NCl3 NH3 (g) + H2O (l) =NH4 + OH Na(s)+H2O(l)=H2(g) + Na2O NI3 (s) = N2 (g) + I2(g) Na3(PO4)(aq) +AlCl3(aq) = NaCl +Al(PO4) Na3(PO4)(aq) +AlCl3(aq) = NaCl(s) +Al(PO4)(aq) Na2SO3+H2SO4=Na2SO4+H2O+SO2 NaOCl + NaCl + H2SO4= Na2Cl + SO3 +H2O Na3(PO4) +AlCl3 = NaCl +Al(PO4) NaOH + HCl = NaCl + H2O NaBr+CaF2=NaF+CaBr2 NH4NO3=N2O+H2O Na2CO3+HCl=NaCl+H2O+CO2 NaNO3 +MnBr2= NaBr +Mn(NO3)2 NaCl + Ag2SO4 = Na2SO4 + AgCl Na+H2O= NaOH+H2 N2+H2=NH3 N2H4=NH3+N2 NH3 + O2 = NO + H2O Na+O2=Na2O N2H4 + KBrO3 = N2 + KBr + H2O NH4NO3=N2O+H2O NaOH+H2CO3=Na2CO3+H2O

= 0Na2ZnO2 + 10K2ZnO2 + 0NH3 + H20 NH3 + HCl = NH4Cl 2Na2S2O3 + I2 = 2NaI + Na2S4O6 N2 + 3Cl2 = 2NCl3 NH3(g) + H2O(l) = NH4 + OH 2Na(s) + H2O(l) = H2(g) + Na2O 2NI3(s) = N2(g) + 3I2(g) Na3(PO4)(aq) + AlCl3(aq) = 3NaCl + Al(PO4) Na3(PO4)(aq) + AlCl3(aq) = 3NaCl(s) + Al(PO4)(aq) Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2 0NaOCl + 0NaCl + H2SO4 = 0Na2Cl + SO3 + H2O Na3(PO4) + AlCl3 = 3NaCl + Al(PO4) NaOH + HCl = NaCl + H2O 2NaBr + CaF2 = 2NaF + CaBr2 NH4NO3 = N2O + 2H2O Na2CO3 + 2HCl = 2NaCl + H2O + CO2 2NaNO3 + MnBr2 = 2NaBr + Mn(NO3)2 2NaCl + Ag2SO4 = Na2SO4 + 2AgCl 2Na + 2H2O = 2NaOH + H2 N2 + 3H2 = 2NH3 3N2H4 = 4NH3 + N2 4NH3 + 5O2 = 4NO + 6H2O 4Na + O2 = 2Na2O 3N2H4 + 2KBrO3 = 3N2 + 2KBr + 6H2O NH4NO3 = N2O + 2H2O 2NaOH + H2CO3 =

NH3+O2=NO+H2O N2H4 = NH3+ N2 N2 + O2 = NO NI3 = N2 + I2 NO2 + H2O = HNO3 + NO NaBr2 + Cl2 = NaCl+ Br NaH(SO3)+H(NO3)=Na(NO3)+H2O+SO2 Na3P + H2O = PH3 + NaOH Na+ N2 = Na3N Na + Cl = NaCl N2O5 + H2O = HNO3 N2+O2=N2O5 NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq) Na+O2=NaO2 NH3 + O2 = NO + H2O Na+NaNO3=NaO+N2 Na+NaNO3=Na2O=N2 Ni + Pb(NO3)2 = Pb + Ni(NO3) Ni + Pb(NO3)2 = Pb + Ni(NO3) NH3+O2=NO+H2O N2 + O2 = N2O5 NO2+H2O=O2+HNO3 NaI + Br2 = NaBr + I NH3+O2=NO+H2O Na + F2 = NaF N2+H2=NH3 NH3 + O2 = N2 + H2O NH3+O2=NO+H2O

Na2CO3 + 2H2O 4NH3 + 5O2 = 4NO + 6H2O 3N2H4 = 4NH3 + N2 N2 + O2 = 2NO 2NI3 = N2 + 3I2 3NO2 + H2O = 2HNO3 + NO 2NaBr2 + Cl2 = 2NaCl + 4Br NaH(SO3) + H(NO3) = Na(NO3) + H2O + SO2 Na3P + 3H2O = PH3 + 3NaOH 6Na + N2 = 2Na3N Na + Cl = NaCl N2O5 + H2O = 2HNO3 2N2 + 5O2 = 2N2O5 NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq) Na + O2 = NaO2 4NH3 + 5O2 = 4NO + 6H2O 4Na + 2NaNO3 = 6NaO + N2 10Na + 2NaNO3 = 6Na2O + N2 2Ni + Pb(NO3)2 = Pb + 2Ni(NO3) 2Ni + Pb(NO3)2 = Pb + 2Ni(NO3) 4NH3 + 5O2 = 4NO + 6H2O 2N2 + 5O2 = 2N2O5 4NO2 + 2H2O = -1O2 + 4HNO3 2NaI + Br2 = 2NaBr + 2I 4NH3 + 5O2 = 4NO + 6H2O 2Na + F2 = 2NaF N2 + 3H2 = 2NH3 4NH3 + 3O2 = 2N2 + 6H2O 4NH3 + 5O2 = 4NO +

NH3(g) + O2(g) = NO2(g) + H2O(g) N2 + H2 = NH3 N + H = NH3 Na2S(aq)+CaCl2(aq)=NaCl+SCa Na+H2O=NaOH+H2 Na NO3 = Na NO2 + O2 NiCO3 + H3O+ = H2O + Ni++ + H2CO3 Na2O + H2O = NaOH Na+H2O=NaOH+H2 NaClO3=NaCl+O2 NH3+O2=2N2+6H2O NaBr2 + Cl = NaCl + Br NaNO3 + H2SO4 = Na2SO4 + HNO3 NH3(l)+O2(g)=2N2(g)+6H2O(l) Na+Br2=NaBr N2 + Cl2 =NCl NH3+O2(g)=2N2(g)+6H2O2(l) Na+H2O=NaOH+H2 Na2CO3+HNO3=CO2+NaNO3+H2O Na2CO3+HNO3=CO2+NaNO3+H2O NH3+O2=2N2+6H2O NO = N2O + O2 Na2CO3+HCl=NaCl+CO2+H2O NO2(g)+O2(g)=N2O5(g) NaCl2 + AgNo3 = Na No3 + Ag Cl2 NH3+O2=NO+H2O

6H2O 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g) N2 + 3H2 = 2NH3 N + 3H = NH3 Na2S(aq) + CaCl2(aq) = 2NaCl + SCa 2Na + 2H2O = 2NaOH + H2 2NaNO3 = 2NaNO2 + O2 NiCO3 + 2H3O+ = 2H2O + Ni++ + H2CO3 Na2O + H2O = 2NaOH 2Na + 2H2O = 2NaOH + H2 2NaClO3 = 2NaCl + 3O2 4NH3 + 3O2 = 2N2 + 6H2O NaBr2 + Cl = NaCl + 2Br 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3 4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l) 2Na + Br2 = 2NaBr N2 + Cl2 = 2NCl 2NH3 + 3O2(g) = N2(g) + 3H2O2(l) 2Na + 2H2O = 2NaOH + H2 Na2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O Na2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O 4NH3 + 3O2 = 2N2 + 6H2O 4NO = 2N2O + O2 Na2CO3 + 2HCl = 2NaCl + CO2 + H2O 4NO2(g) + O2(g) = 2N2O5(g) NaCl2 + AgNo3 = NaNo3 + AgCl2 4NH3 + 5O2 = 4NO + 6H2O

NaOH+HNO3=H2O+NaNO3 NH3+O2(g)=2N2(g)+6H2O2(l) Na2CO3+ Mg(NO2)2=MgCO3+NaNO2 N2H4=NH3+N2 NaOH +HF = NaF + H2O Na2S(s) + 2 HCl(aq) = SCl2(aq) + 2 NaH (s) Na2S(s) + 2 HCl(aq) = H2S (g) + Cl2(g) +2 Na(s) Na2 +OH = NaOH Na2 +OH = NaOH Na + Cl2 = NaCl NaF+FeCl3=Na3FeF6+NaCl N2+H2=NH3 NH4NO3=N2O+H2O Na2CO3 + HCl = NaCl + CO2 + H2O NH4SCN+Hg(NO3)2=Hg(SCN)2+NH4NO3 Na2O + H2O = NaOH NH3 + O2 = NO + H2O NH4OH+HNO3=NH4NO3+H2O NO+O2=NO2 NH4OH+HNO=NH4NO3+H2O NH3 + O2 = NO + H2O NH4OH+HNO=NH4NO3+H2O NH4OH+HNO=NH4NO+H2O Na + H2O = H2 + NaOH NO2(g)+O2(g)=N2O5(g) Na2CO3 + 2KF = 2NaF + K2CO3 Na+I2=NaI2

NaOH + HNO3 = H2O + NaNO3 2NH3 + 3O2(g) = N2(g) + 3H2O2(l) Na2CO3 + Mg(NO2)2 = MgCO3 + 2NaNO2 3N2H4 = 4NH3 + N2 NaOH + HF = NaF + H2O Na2S(s) + 2HCl(aq) = SCl2(aq) + 2NaH(s) Na2S(s) + 2HCl(aq) = H2S(g) + Cl2(g) + 2Na(s) Na2 + 2OH = 2NaOH Na2 + 2OH = 2NaOH 2Na + Cl2 = 2NaCl 6NaF + FeCl3 = Na3FeF6 + 3NaCl N2 + 3H2 = 2NH3 NH4NO3 = N2O + 2H2O Na2CO3 + 2HCl = 2NaCl + CO2 + H2O 2NH4SCN + Hg(NO3)2 = Hg(SCN)2 + 2NH4NO3 Na2O + H2O = 2NaOH 4NH3 + 5O2 = 4NO + 6H2O NH4OH + HNO3 = NH4NO3 + H2O 2NO + O2 = 2NO2 0NH4OH - 2HNO = 1NH4NO3 + H2O 4NH3 + 5O2 = 4NO + 6H2O 0NH4OH - 2HNO = 1NH4NO3 + H2O NH4OH + HNO = NH4NO + H2O 2Na + 2H2O = H2 + 2NaOH 4NO2(g) + O2(g) = 2N2O5(g) Na2CO3 + 2KF = 2NaF + K2CO3 Na + I2 = NaI2

Na+I2=NaI2 Na + H2O = NaOH + H2 NH4NO3(s)=N2(g)+O2(g)=H2O(g) N2 + H2 = NH3 NO2 + NH3 = N2 + H2O NO2 + NH3 = N2 = H2O NaHCO3(s)=Na(s)+HCO3(s) Na3Po3 + CaCl2 = Na3Cl2 + CaPo3 NaOH+H3PO4=Na3PO4+H2O NaCl+H2SO4=2HCl+Na2SO4 Na+O2=Na2O NH3 + O2 = NO + H2O NaNO3=NaNO2+O2 Na2O2+H2O= NaOH+H2O2 N2 + H2 = NH3 NaNO3 = NaNO2 + O2 NaCl + Ag2SO4 = Na2SO4 + AgCl NH3 + O2 = NO + H2O Ni(s) +K2SO4(aq)=NiSO4+K2 Na2CrO4 + KIO3 = Na2IO3 + KCrO4 NaOH + KIO3 = NaIO3 + KOH NaOH + Na2CrO4 = NaCrO4 + Na2OH NaBr (aq) + Cl2 (g) = NaCl (aq) + Br2 (g) NaHCO3=Na2CO3+H2O+CO2 Na (s) + H2O (l) = NaOH (aq) + H2 (g)

Na + I2 = NaI2 2Na + 2H2O = 2NaOH + H2 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g) N2 + 3H2 = 2NH3 6NO2 + 8NH3 = 7N2 + 12H2O 6NO2 + 8NH3 = 7N2 + 12H2O NaHCO3(s) = Na(s) + HCO3(s) Na3Po3 + CaCl2 = Na3Cl2 + CaPo3 3NaOH + H3PO4 = Na3PO4 + 3H2O 2NaCl + H2SO4 = 2HCl + Na2SO4 4Na + O2 = 2Na2O 4NH3 + 5O2 = 4NO + 6H2O 2NaNO3 = 2NaNO2 + O2 Na2O2 + 2H2O = 2NaOH + H2O2 N2 + 3H2 = 2NH3 2NaNO3 = 2NaNO2 + O2 2NaCl + Ag2SO4 = Na2SO4 + 2AgCl 4NH3 + 5O2 = 4NO + 6H2O Ni(s) + K2SO4(aq) = NiSO4 + K2 Na2CrO4 + KIO3 = Na2IO3 + KCrO4 NaOH + KIO3 = NaIO3 + KOH NaOH + Na2CrO4 = NaCrO4 + Na2OH 2NaBr(aq) + Cl2(g) = 2NaCl(aq) + Br2(g) 2NaHCO3 = Na2CO3 + H2O + CO2 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)

3N2H4(l) = 4NH3(g) + N2(g) N2 + H2 = NH3 N2 + 3H2 = 2NH3 Na3PO4 + AgNO3 = Na3PO4+AgNO3=Na3NO3+AgPO4 Na3NO3 + AgPO4 4NH3 + 5O2 = 4NO + NH3 + O2 = NO + H2O 6H2O 4NH3 + 5O2 = 4NO + NH3 + O2 = NO = H2O 6H2O Na3 + PO4 + AgNO3 = Na3+PO4+AgNO3=Na3NO3+AgPO4 Na3NO3 + AgPO4 NiCl2 + Na2S = NiS + NiCl2+Na2S=NiS+2NaCl 2NaCl 2Na + 2H2O = 2NaOH + Na + H2O =NaOH + H2 H2 2Na + 2H2O = 2NaOH + Na + H2O =NaOH + H2 H2 NO + O2 = NO2 2NO + O2 = 2NO2 N2 + O2 = NO N2 + O2 = 2NO Na2S(s) + 2HCl(aq) = Na2S(s) + HCl(aq) = H2S(g) + NaCl(aq) H2S(g) + 2NaCl(aq) Na2CO3 + Pb(NO3)2 = Na2CO3 + Pb(NO3)2 = NaNO3 + PbCO3 2NaNO3 + PbCO3 NH4NO3 = N2O + H2O NH4NO3 = N2O + 2H2O N2O5 + H2O = HNO3 N2O5 + H2O = 2HNO3 NaHCO3 + HC2H3O2 = NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2 NaC2H3O2 + H2O + CO2 2Na + 2H2O = 2NaOH + Na+H2O=NaOH+H2 H2 Na2S + CaCl2 = 2NaCl + Na2S+ CaCl2=NaCl+CaS CaS N2+O2=NO2 N2 + 2O2 = 2NO2 Na(s) + O2(g) = NaO2 Na(s) + O2(g) = NaO2 2NH4SCN + Hg(NO3)2 = NH4SCN + Hg(NO3)2 = Hg(SCN)2 + NH4NO3 Hg(SCN)2 + 2NH4NO3 NH4OH + HNO3 = NH4OH + HNO3 = NH4NO3 + H2O NH4NO3 + H2O 2NaCl + H2SO4 = NaCl + H2SO4 = Na2SO4 + HCl Na2SO4 + 2HCl NaHCO3(s) + NaHCO3(s) + HC2H3O2(aq) = NaC2H3O2(aq) +CO2(g) + HC2H3O2(aq) = H2O(l) NaC2H3O2(aq) + CO2(g) + H2O(l) NH3+HCl= NH4Cl NH3 + HCl = NH4Cl N2H4(l) = NH3(g) + N2(g)

NaCl(aq) + CaCl2(aq) = NaCl2 + CaCl N2 + O2 = NO2 NH4OH(aq)+HCl(aq)=NH4Cl(aq)+H2O(l) Na2Cr2O7 + H2SO4 + NaBr = Cr2(SO4)3 + Na2SO4 + Br2+ H2O NaCrO2+NaOH+H2O2=Na2CrO4+H2O NO2 + H2O= NO + HNO3 Na2O+ (NH4)2SO4= Na2SO4 + H2O + NH3 NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O NaOH+Pb=Pb(OH)2+Na NO+O2=NO2 NaOH + H2SO4 = Na2SO4 + H2O Na2S2O3+I2=NaI+Na2S4O6 NaNO3=Na+N+O NaHCO3 + C2H9O2 = NaC2H3O2 + CO2 + H2O NH3 + O2 = NO + H20 NaClO2 + Cl2 = ClO2 +NaCl NaCl+AgNO3=AgCl+NaNO3 Na(s) + O2(g) = NaO2 NH3 + O2 = NO2 + NH3 Na3PO4+Ba(OH)2=NaOH+Ba3(PO4)2 Na2CO3 + CaCl2 = NaCl + CaCO3 NaCl + F2 = NaF + Cl2 N2 + H2 = NH3 NO2+H2=NH4+H2O

NaCl(aq) + CaCl2(aq) = NaCl2 + CaCl N2 + 2O2 = 2NO2 NH4OH(aq) + HCl(aq) = NH4Cl(aq) + H2O(l) Na2Cr2O7 + 7H2SO4 + 6NaBr = Cr2(SO4)3 + 4Na2SO4 + 3Br2 + 7H2O 2NaCrO2 + 2NaOH + 3H2O2 = 2Na2CrO4 + 4H2O 3NO2 + H2O = NO + 2HNO3 Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3 2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O 2NaOH + Pb = Pb(OH)2 + 2Na 2NO + O2 = 2NO2 2NaOH + H2SO4 = Na2SO4 + 2H2O 2Na2S2O3 + I2 = 2NaI + Na2S4O6 NaNO3 = Na + N + 3O 13NaHCO3 + 8C2H9O2 = 13NaC2H3O2 + 3CO2 + 23H2O 20NH3 + 10O2 = 20NO + 3H20 2NaClO2 + Cl2 = 2ClO2 + 2NaCl NaCl + AgNO3 = AgCl + NaNO3 Na(s) + O2(g) = NaO2 NH3 + 0O2 = 0NO2 + NH3 2Na3PO4 + 3Ba(OH)2 = 6NaOH + Ba3(PO4)2 Na2CO3 + CaCl2 = 2NaCl + CaCO3 2NaCl + F2 = 2NaF + Cl2 N2 + 3H2 = 2NH3 NO2 + 4H2 = NH4 + 2H2O

NaOH+HCl= ClNa+H2O NH4OH+FeCl3=NH4Cl+Fe(OH)3 Na2SO3 + H2O = Na2SO4 + H2O NH3+CO2=(NH2)2CO+H2O N2H4 = NH3 + N2 NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g) Ni(s) + SnSO4(aq) = NiSO4(aq) + Sn(s) NH3(g) + O2(g) = N2(g) + H2O(g) Na(s)+H2O(l)=NaOH(aq)+H2(g) N2+H2=NH3 Na2S2O3+I2=NaI+Na2S4O6 NH4 + Cl + Ca(OH)2 = CaCl2 + H2O + NH3 NaOH+Al2(SO3)3=Na2SO3+Al(OH)3 NH3+O2=NO+H2O NH4I=NH4+I NiCl2(aq) + Na2CO3(aq) = NiNa2 + Cl2CO3 NH3+O2=H2O+NO2 Na2O2 + CO2 = Na2CO3 + O2 Na2O2 + CO2 = Na2CO3 + O Na2O2 + CO2 = Na2CO4 NaHCO3 + HCl = CO2 + H2O + NaCl Na + H2O = NaOH + H2 NaOH + KHP = NaKP + H2O NaOH + KHP = NaKP + H2O

NaOH + HCl = ClNa + H2O 3NH4OH + FeCl3 = 3NH4Cl + Fe(OH)3 0Na2SO3 + H2O = 0Na2SO4 + H2O 2NH3 + CO2 = (NH2)2CO + H2O 3N2H4 = 4NH3 + N2 2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g) Ni(s) + SnSO4(aq) = NiSO4(aq) + Sn(s) 4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g) N2 + 3H2 = 2NH3 2Na2S2O3 + I2 = 2NaI + Na2S4O6 2NH4 + 2Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3 6NaOH + Al2(SO3)3 = 3Na2SO3 + 2Al(OH)3 4NH3 + 5O2 = 4NO + 6H2O NH4I = NH4 + I NiCl2(aq) + Na2CO3(aq) = NiNa2 + Cl2CO3 4NH3 + 7O2 = 6H2O + 4NO2 2Na2O2 + 2CO2 = 2Na2CO3 + O2 Na2O2 + CO2 = Na2CO3 +O Na2O2 + CO2 = Na2CO4 NaHCO3 + HCl = CO2 + H2O + NaCl 2Na + 2H2O = 2NaOH + H2 NaOH + KHP = NaKP + H2O NaOH + KHP = NaKP + H2O

NH3+O2=H2O+NO2 NH3+O2=H2O+NO2 NO3+H20=NH3+3OH NaCl+H2SO4+O2=Na2SO4+Cl2+H20 NH4OH + H2SO4 = (NH4)2SO4 + H2O Na2S+Cu(NO3)2 = NaNO3+CuS NH4NO3 = N2O+ H2O N2+H2=NH3 Na + H2O = NaOH + H2 N2+H2=NH3 Na3PO4 + Ba(NO3)2 = NaNO3 + Ba3(PO4)2

4NH3 + 7O2 = 6H2O + 4NO2 4NH3 + 7O2 = 6H2O + 4NO2 10NO3 + 3H20 = 10NH3 + 30OH 20NaCl + 10H2SO4 + 0O2 = 10Na2SO4 + 10Cl2 + H20 2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O Na2S + Cu(NO3)2 = 2NaNO3 + CuS NH4NO3 = N2O + 2H2O N2 + 3H2 = 2NH3 2Na + 2H2O = 2NaOH + H2 N2 + 3H2 = 2NH3 2Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2